C20H23F3N2O3S — CID 58198687
N-(3-tert-butylphenyl)-2-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propanamide (PubChem CID 58198687) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-2-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propanamide.
| Compound Name | N-(3-tert-butylphenyl)-2-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propanamide |
|---|---|
| PubChem CID | 58198687 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-(3-tert-butylphenyl)-2-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propanamide |
| SMILES | CC(C)(C)c1cccc(NC(=O)C(C)(C)S(=O)(=O)c2ccc(C(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C20H23F3N2O3S/c1-18(2,3)13-7-6-8-14(11-13)25-17(26)19(4,5)29(27,28)15-9-10-16(24-12-15)20(21,22)23/h6-12H,1-5H3,(H,25,26) |
| InChIKey | QWZXFWMIFGLYRB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |