C28H36N4O3 — CID 58199081
4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-N-methyl-N-phenylpiperazine-1-carboxamide (PubChem CID 58199081) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-N-methyl-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-N-methyl-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 58199081 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-N-methyl-N-phenylpiperazine-1-carboxamide |
| SMILES | CN(C(=O)N1CCN(c2ccc3c(c2)COC2(CCN(C4CCC4)CC2)O3)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H36N4O3/c1-29(23-6-3-2-4-7-23)27(33)32-18-16-31(17-19-32)25-10-11-26-22(20-25)21-34-28(35-26)12-14-30(15-13-28)24-8-5-9-24/h2-4,6-7,10-11,20,24H,5,8-9,12-19,21H2,1H3 |
| InChIKey | AVJSYQNPCHYBBA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|