C24H28N4O — CID 58199828
4-[3-[4-[3-(piperidin-3-ylamino)phenyl]pyrimidin-2-yl]propyl]phenol (PubChem CID 58199828) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-[3-[4-[3-(piperidin-3-ylamino)phenyl]pyrimidin-2-yl]propyl]phenol.
| Compound Name | 4-[3-[4-[3-(piperidin-3-ylamino)phenyl]pyrimidin-2-yl]propyl]phenol |
|---|---|
| PubChem CID | 58199828 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 4-[3-[4-[3-(piperidin-3-ylamino)phenyl]pyrimidin-2-yl]propyl]phenol |
| SMILES | Oc1ccc(CCCc2nccc(-c3cccc(NC4CCCNC4)c3)n2)cc1 |
| InChI | InChI=1S/C24H28N4O/c29-22-11-9-18(10-12-22)4-1-8-24-26-15-13-23(28-24)19-5-2-6-20(16-19)27-21-7-3-14-25-17-21/h2,5-6,9-13,15-16,21,25,27,29H,1,3-4,7-8,14,17H2 |
| InChIKey | VGKYURUNMSEYMQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |