C25H28N4O2 — CID 58199790
N-[3-[2-[3-(1,3-benzodioxol-5-yl)propyl]pyrimidin-4-yl]phenyl]piperidin-4-amine (PubChem CID 58199790) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[3-[2-[3-(1,3-benzodioxol-5-yl)propyl]pyrimidin-4-yl]phenyl]piperidin-4-amine.
| Compound Name | N-[3-[2-[3-(1,3-benzodioxol-5-yl)propyl]pyrimidin-4-yl]phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 58199790 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[3-[2-[3-(1,3-benzodioxol-5-yl)propyl]pyrimidin-4-yl]phenyl]piperidin-4-amine |
| SMILES | c1cc(NC2CCNCC2)cc(-c2ccnc(CCCc3ccc4c(c3)OCO4)n2)c1 |
| InChI | InChI=1S/C25H28N4O2/c1(3-18-7-8-23-24(15-18)31-17-30-23)6-25-27-14-11-22(29-25)19-4-2-5-21(16-19)28-20-9-12-26-13-10-20/h2,4-5,7-8,11,14-16,20,26,28H,1,3,6,9-10,12-13,17H2 |
| InChIKey | QUIOPKYRJAYHAW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |