C16H32O10 — CID 58201976
(2R,3S,4R,5S)-7,7-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-1,2,3,5-tetrol (PubChem CID 58201976) has the molecular formula C16H32O10 and a molecular weight of 384.42 g/mol. Its IUPAC name is (2R,3S,4R,5S)-7,7-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-1,2,3,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-7,7-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 58201976 |
| Molecular Formula | C16H32O10 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2R,3S,4R,5S)-7,7-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-1,2,3,5-tetrol |
| SMILES | CC(C)(C)C[C@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H32O10/c1-16(2,3)4-7(19)14(10(21)8(20)5-17)26-15-13(24)12(23)11(22)9(6-18)25-15/h7-15,17-24H,4-6H2,1-3H3/t7-,8+,9+,10-,11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | BCMYNFYIBSKPOB-KXEXLPOGSA-N |
| XLogP | -3.32 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |