C14H20N4O2S — CID 58202128
benzyl (3R)-3-[aminocarbamothioyl(methyl)amino]pyrrolidine-1-carboxylate (PubChem CID 58202128) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is benzyl (3R)-3-[aminocarbamothioyl(methyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[aminocarbamothioyl(methyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58202128 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | benzyl (3R)-3-[aminocarbamothioyl(methyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CN(C(=S)NN)[C@@H]1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C14H20N4O2S/c1-17(13(21)16-15)12-7-8-18(9-12)14(19)20-10-11-5-3-2-4-6-11/h2-6,12H,7-10,15H2,1H3,(H,16,21)/t12-/m1/s1 |
| InChIKey | SXRSVODQKXERTD-GFCCVEGCSA-N |
| XLogP | 1.08 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|