C40H35IrN3O-2 — CID 58203020
iridium;9-methyl-4-phenyl-9-[(6-phenyl-3-pyridinyl)methyl]-3,17-diazatricyclo[11.3.1.02,7]heptadeca-1(16),2(7),3,5,13(17),14-hexaene;phenol (PubChem CID 58203020) has the molecular formula C40H35IrN3O-2 and a molecular weight of 765.96 g/mol. Its IUPAC name is iridium;9-methyl-4-phenyl-9-[(6-phenyl-3-pyridinyl)methyl]-3,17-diazatricyclo[11.3.1.02,7]heptadeca-1(16),2(7),3,5,13(17),14-hexaene;phenol.
| Compound Name | iridium;9-methyl-4-phenyl-9-[(6-phenyl-3-pyridinyl)methyl]-3,17-diazatricyclo[11.3.1.02,7]heptadeca-1(16),2(7),3,5,13(17),14-hexaene;phenol |
|---|---|
| PubChem CID | 58203020 |
| Molecular Formula | C40H35IrN3O-2 |
| Molecular Weight | 765.96 g/mol |
| Exact Mass | 766.24 |
| IUPAC Name | iridium;9-methyl-4-phenyl-9-[(6-phenyl-3-pyridinyl)methyl]-3,17-diazatricyclo[11.3.1.02,7]heptadeca-1(16),2(7),3,5,13(17),14-hexaene;phenol |
| SMILES | CC1(Cc2ccc(-c3[c-]cccc3)nc2)CCCc2cccc(n2)-c2nc(-c3[c-]cccc3)ccc2C1.Oc1ccccc1.[Ir] |
| InChI | InChI=1S/C34H29N3.C6H6O.Ir/c1-34(22-25-17-19-30(35-24-25)26-10-4-2-5-11-26)21-9-15-29-14-8-16-32(36-29)33-28(23-34)18-20-31(37-33)27-12-6-3-7-13-27;7-6-4-2-1-3-5-6;/h2-8,10,12,14,16-20,24H,9,15,21-23H2,1H3;1-5,7H;/q-2;; |
| InChIKey | QBMYJLARVBJXHX-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.96 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|