C20H24BrN3O4S — CID 58204215
tert-butyl N-[(8-bromo-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole-2-carbonyl)-propan-2-ylamino]carbamate (PubChem CID 58204215) has the molecular formula C20H24BrN3O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is tert-butyl N-[(8-bromo-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole-2-carbonyl)-propan-2-ylamino]carbamate.
| Compound Name | tert-butyl N-[(8-bromo-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole-2-carbonyl)-propan-2-ylamino]carbamate |
|---|---|
| PubChem CID | 58204215 |
| Molecular Formula | C20H24BrN3O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | tert-butyl N-[(8-bromo-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole-2-carbonyl)-propan-2-ylamino]carbamate |
| SMILES | CC(C)N(NC(=O)OC(C)(C)C)C(=O)c1nc2c(s1)CCOc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C20H24BrN3O4S/c1-11(2)24(23-19(26)28-20(3,4)5)18(25)17-22-16-13-7-6-12(21)10-14(13)27-9-8-15(16)29-17/h6-7,10-11H,8-9H2,1-5H3,(H,23,26) |
| InChIKey | OOVUDXIIEGCBAX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|