C9H17N3O — CID 58204408
[1,5-di(propan-2-yl)-1,2,4-triazol-3-yl]methanol (PubChem CID 58204408) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is [1,5-di(propan-2-yl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [1,5-di(propan-2-yl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 58204408 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | [1,5-di(propan-2-yl)-1,2,4-triazol-3-yl]methanol |
| SMILES | CC(C)c1nc(CO)nn1C(C)C |
| InChI | InChI=1S/C9H17N3O/c1-6(2)9-10-8(5-13)11-12(9)7(3)4/h6-7,13H,5H2,1-4H3 |
| InChIKey | XACJPTUZKZAQMK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |