C15H10F6N6O4S — CID 58204665
[4-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaen-12-yl] trifluoromethanesulfonate (PubChem CID 58204665) has the molecular formula C15H10F6N6O4S and a molecular weight of 484.34 g/mol. Its IUPAC name is [4-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaen-12-yl] trifluoromethanesulfonate.
| Compound Name | [4-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaen-12-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58204665 |
| Molecular Formula | C15H10F6N6O4S |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | [4-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaen-12-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cn1)-c1nc(-c3ncnn3CC(F)(F)F)cn1CCO2)C(F)(F)F |
| InChI | InChI=1S/C15H10F6N6O4S/c16-14(17,18)6-27-13(23-7-24-27)9-5-26-1-2-30-10-3-11(22-4-8(10)12(26)25-9)31-32(28,29)15(19,20)21/h3-5,7H,1-2,6H2 |
| InChIKey | SZYKXQQBPYVCSD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|