C20H19F3N6O3 — CID 58205035
morpholin-4-yl-[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-10-yl]methanone (PubChem CID 58205035) has the molecular formula C20H19F3N6O3 and a molecular weight of 448.41 g/mol. Its IUPAC name is morpholin-4-yl-[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-10-yl]methanone.
| Compound Name | morpholin-4-yl-[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-10-yl]methanone |
|---|---|
| PubChem CID | 58205035 |
| Molecular Formula | C20H19F3N6O3 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | morpholin-4-yl-[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-10-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)-c1nc(-c3ncnn3CC(F)(F)F)cn1CCO2)N1CCOCC1 |
| InChI | InChI=1S/C20H19F3N6O3/c21-20(22,23)11-29-18(24-12-25-29)15-10-28-5-8-32-16-2-1-13(9-14(16)17(28)26-15)19(30)27-3-6-31-7-4-27/h1-2,9-10,12H,3-8,11H2 |
| InChIKey | LFRUHWPPVWXPGM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |