C27H33N5O2 — CID 58205176
4-tert-butyl-N-[2-[(4-tert-butylbenzoyl)amino]-6-(methylamino)pyrimidin-4-yl]benzamide (PubChem CID 58205176) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[(4-tert-butylbenzoyl)amino]-6-(methylamino)pyrimidin-4-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[(4-tert-butylbenzoyl)amino]-6-(methylamino)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 58205176 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-tert-butyl-N-[2-[(4-tert-butylbenzoyl)amino]-6-(methylamino)pyrimidin-4-yl]benzamide |
| SMILES | CNc1cc(NC(=O)c2ccc(C(C)(C)C)cc2)nc(NC(=O)c2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C27H33N5O2/c1-26(2,3)19-12-8-17(9-13-19)23(33)29-22-16-21(28-7)30-25(31-22)32-24(34)18-10-14-20(15-11-18)27(4,5)6/h8-16H,1-7H3,(H3,28,29,30,31,32,33,34) |
| InChIKey | ZTYIPQTZGYBJKA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |