C24H27N5O2 — CID 58205211
N-[6-(diethylamino)-2-[(3-methylbenzoyl)amino]pyrimidin-4-yl]-3-methylbenzamide (PubChem CID 58205211) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[6-(diethylamino)-2-[(3-methylbenzoyl)amino]pyrimidin-4-yl]-3-methylbenzamide.
| Compound Name | N-[6-(diethylamino)-2-[(3-methylbenzoyl)amino]pyrimidin-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 58205211 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[6-(diethylamino)-2-[(3-methylbenzoyl)amino]pyrimidin-4-yl]-3-methylbenzamide |
| SMILES | CCN(CC)c1cc(NC(=O)c2cccc(C)c2)nc(NC(=O)c2cccc(C)c2)n1 |
| InChI | InChI=1S/C24H27N5O2/c1-5-29(6-2)21-15-20(25-22(30)18-11-7-9-16(3)13-18)26-24(27-21)28-23(31)19-12-8-10-17(4)14-19/h7-15H,5-6H2,1-4H3,(H2,25,26,27,28,30,31) |
| InChIKey | FOAHZIJXEQXILI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |