C30H32FN3O3S — CID 58207647
cyclohexyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate (PubChem CID 58207647) has the molecular formula C30H32FN3O3S and a molecular weight of 533.67 g/mol. Its IUPAC name is cyclohexyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate.
| Compound Name | cyclohexyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 58207647 |
| Molecular Formula | C30H32FN3O3S |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | cyclohexyl 2-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetate |
| SMILES | CCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)OC5CCCCC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C30H32FN3O3S/c1-2-13-32-18-21-8-10-24(34-19-21)28-17-25-30(38-28)27(12-14-33-25)37-26-11-9-20(15-23(26)31)16-29(35)36-22-6-4-3-5-7-22/h8-12,14-15,17,19,22,32H,2-7,13,16,18H2,1H3 |
| InChIKey | LTXWSGKQHAZOBV-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|