C26H33N5O2S — CID 58208085
1-[[6-[2-(4-aminothiophen-3-yl)acetyl]-3-pyridinyl]methyl]-1-[2-(dimethylamino)ethyl]-3-(3-phenylpropyl)urea (PubChem CID 58208085) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is 1-[[6-[2-(4-aminothiophen-3-yl)acetyl]-3-pyridinyl]methyl]-1-[2-(dimethylamino)ethyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[[6-[2-(4-aminothiophen-3-yl)acetyl]-3-pyridinyl]methyl]-1-[2-(dimethylamino)ethyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 58208085 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 1-[[6-[2-(4-aminothiophen-3-yl)acetyl]-3-pyridinyl]methyl]-1-[2-(dimethylamino)ethyl]-3-(3-phenylpropyl)urea |
| SMILES | CN(C)CCN(Cc1ccc(C(=O)Cc2cscc2N)nc1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H33N5O2S/c1-30(2)13-14-31(26(33)28-12-6-9-20-7-4-3-5-8-20)17-21-10-11-24(29-16-21)25(32)15-22-18-34-19-23(22)27/h3-5,7-8,10-11,16,18-19H,6,9,12-15,17,27H2,1-2H3,(H,28,33) |
| InChIKey | SGYINYDFBYHYEG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|