C28H40BrNO6 — CID 58212702
methyl (2S,4S)-4-[(4-bromophenyl)methoxy]-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate (PubChem CID 58212702) has the molecular formula C28H40BrNO6 and a molecular weight of 566.53 g/mol. Its IUPAC name is methyl (2S,4S)-4-[(4-bromophenyl)methoxy]-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[(4-bromophenyl)methoxy]-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58212702 |
| Molecular Formula | C28H40BrNO6 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | methyl (2S,4S)-4-[(4-bromophenyl)methoxy]-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N1C[C@@H](OCc2ccc(Br)cc2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C28H40BrNO6/c1-6-7-8-9-10-11-21(16-25(31)36-28(2,3)4)26(32)30-18-23(17-24(30)27(33)34-5)35-19-20-12-14-22(29)15-13-20/h6,12-15,21,23-24H,1,7-11,16-19H2,2-5H3/t21-,23+,24+/m1/s1 |
| InChIKey | FKWKKPKYYZUQPP-NHTMILBNSA-N |
| XLogP | 5.59 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|