C31H33BrN4O10S — CID 157079191
methyl (2S,4R)-4-(7-bromoisoquinolin-1-yl)oxy-1-[(2S)-2-[[(2-nitrophenyl)sulfonylamino]methyl]-4-oxo-4-pent-4-enoxybutanoyl]pyrrolidine-2-carboxylate (PubChem CID 157079191) has the molecular formula C31H33BrN4O10S and a molecular weight of 733.59 g/mol. Its IUPAC name is methyl (2S,4R)-4-(7-bromoisoquinolin-1-yl)oxy-1-[(2S)-2-[[(2-nitrophenyl)sulfonylamino]methyl]-4-oxo-4-pent-4-enoxybutanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-(7-bromoisoquinolin-1-yl)oxy-1-[(2S)-2-[[(2-nitrophenyl)sulfonylamino]methyl]-4-oxo-4-pent-4-enoxybutanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 157079191 |
| Molecular Formula | C31H33BrN4O10S |
| Molecular Weight | 733.59 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | methyl (2S,4R)-4-(7-bromoisoquinolin-1-yl)oxy-1-[(2S)-2-[[(2-nitrophenyl)sulfonylamino]methyl]-4-oxo-4-pent-4-enoxybutanoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCCOC(=O)C[C@@H](CNS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)N1C[C@H](Oc2nccc3ccc(Br)cc23)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C31H33BrN4O10S/c1-3-4-7-14-45-28(37)15-21(18-34-47(42,43)27-9-6-5-8-25(27)36(40)41)30(38)35-19-23(17-26(35)31(39)44-2)46-29-24-16-22(32)11-10-20(24)12-13-33-29/h3,5-6,8-13,16,21,23,26,34H,1,4,7,14-15,17-19H2,2H3/t21-,23+,26-/m0/s1 |
| InChIKey | ADIFEDPJAVLFEC-SYVJQLTCSA-N |
| XLogP | 3.92 |
| TPSA | 184.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|