C32H35N5O10S — CID 68613130
(2S,4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[(2S)-3-[(2-nitrophenyl)sulfonylamino]-2-(pent-4-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 68613130) has the molecular formula C32H35N5O10S and a molecular weight of 681.72 g/mol. Its IUPAC name is (2S,4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[(2S)-3-[(2-nitrophenyl)sulfonylamino]-2-(pent-4-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[(2S)-3-[(2-nitrophenyl)sulfonylamino]-2-(pent-4-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68613130 |
| Molecular Formula | C32H35N5O10S |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | (2S,4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[(2S)-3-[(2-nitrophenyl)sulfonylamino]-2-(pent-4-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=CCCCOC(=O)N[C@@H](CNS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)N1C[C@H](Oc2nccc3ccc(C=C)cc23)C[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C32H35N5O10S/c1-4-6-9-16-46-31(41)35-25(19-34-48(44,45)27-11-8-7-10-26(27)37(42)43)29(38)36-20-23(18-32(36,3)30(39)40)47-28-24-17-21(5-2)12-13-22(24)14-15-33-28/h4-5,7-8,10-15,17,23,25,34H,1-2,6,9,16,18-20H2,3H3,(H,35,41)(H,39,40)/t23-,25+,32+/m1/s1 |
| InChIKey | LUOCJVDSVHHYEB-UCRLTYHRSA-N |
| XLogP | 3.65 |
| TPSA | 207.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|