C16H22N2O4S — CID 11035145
N-(3-ethenylidene-2-methylheptyl)-2-nitrobenzenesulfonamide (PubChem CID 11035145) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(3-ethenylidene-2-methylheptyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(3-ethenylidene-2-methylheptyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 11035145 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(3-ethenylidene-2-methylheptyl)-2-nitrobenzenesulfonamide |
| SMILES | C=C=C(CCCC)C(C)CNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O4S/c1-4-6-9-14(5-2)13(3)12-17-23(21,22)16-11-8-7-10-15(16)18(19)20/h7-8,10-11,13,17H,2,4,6,9,12H2,1,3H3 |
| InChIKey | FICDPBLNGCFUJZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|