C23H29N3O4 — CID 90922476
[(2S)-2-amino-3-methylbutanoyl] (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-ethylpyrrolidine-1-carboxylate (PubChem CID 90922476) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-2-amino-3-methylbutanoyl] (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-ethylpyrrolidine-1-carboxylate.
| Compound Name | [(2S)-2-amino-3-methylbutanoyl] (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90922476 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(2S)-2-amino-3-methylbutanoyl] (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-ethylpyrrolidine-1-carboxylate |
| SMILES | C=Cc1ccc2ccnc(O[C@@H]3CC(CC)N(C(=O)OC(=O)[C@@H](N)C(C)C)C3)c2c1 |
| InChI | InChI=1S/C23H29N3O4/c1-5-15-7-8-16-9-10-25-21(19(16)11-15)29-18-12-17(6-2)26(13-18)23(28)30-22(27)20(24)14(3)4/h5,7-11,14,17-18,20H,1,6,12-13,24H2,2-4H3/t17?,18-,20+/m1/s1 |
| InChIKey | VTONWBUTGPAOIO-FLXSOZOKSA-N |
| XLogP | 3.76 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|