C31H42N3O6+ — CID 123394095
ethyl (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[2-(pent-4-enoxycarbonylamino)hexanoyl]pyrrolidin-1-ium-1-carboxylate (PubChem CID 123394095) has the molecular formula C31H42N3O6+ and a molecular weight of 552.69 g/mol. Its IUPAC name is ethyl (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[2-(pent-4-enoxycarbonylamino)hexanoyl]pyrrolidin-1-ium-1-carboxylate.
| Compound Name | ethyl (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[2-(pent-4-enoxycarbonylamino)hexanoyl]pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 123394095 |
| Molecular Formula | C31H42N3O6+ |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | ethyl (4R)-4-(7-ethenylisoquinolin-1-yl)oxy-2-methyl-1-[2-(pent-4-enoxycarbonylamino)hexanoyl]pyrrolidin-1-ium-1-carboxylate |
| SMILES | C=CCCCOC(=O)NC(CCCC)C(=O)[N+]1(C(=O)OCC)C[C@H](Oc2nccc3ccc(C=C)cc23)CC1C |
| InChI | InChI=1S/C31H41N3O6/c1-6-10-12-18-39-30(36)33-27(13-11-7-2)29(35)34(31(37)38-9-4)21-25(19-22(34)5)40-28-26-20-23(8-3)14-15-24(26)16-17-32-28/h6,8,14-17,20,22,25,27H,1,3,7,9-13,18-19,21H2,2,4-5H3/p+1/t22?,25-,27?,34?/m1/s1 |
| InChIKey | XVCBJGNGQBBCTO-PWSHVVIWSA-O |
| XLogP | 6.17 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|