C22H25N3O2S — CID 58213933
2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1-dideuterio-5-hydroxy-5-phenylpentyl]phenyl]acetamide (PubChem CID 58213933) has the molecular formula C22H25N3O2S and a molecular weight of 402.57 g/mol. Its IUPAC name is 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1-dideuterio-5-hydroxy-5-phenylpentyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1-dideuterio-5-hydroxy-5-phenylpentyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58213933 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1-dideuterio-5-hydroxy-5-phenylpentyl]phenyl]acetamide |
| SMILES | [2H]c1sc(N)nc1CC(=O)Nc1c([2H])c([2H])c(C([2H])([2H])CCC[C@H](O)c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C22H25N3O2S/c23-22-25-19(15-28-22)14-21(27)24-18-12-10-16(11-13-18)6-4-5-9-20(26)17-7-2-1-3-8-17/h1-3,7-8,10-13,15,20,26H,4-6,9,14H2,(H2,23,25)(H,24,27)/t20-/m0/s1/i6D2,10D,11D,12D,13D,15D |
| InChIKey | ZLBDXJADQIMLLU-SWFDOLBHSA-N |
| XLogP | 4.35 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |