C23H27N3O2S — CID 58214079
2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1,4,4-tetradeuterio-5-hydroxy-5-(2,3,5,6-tetradeuterio-4-methylphenyl)pentyl]phenyl]acetamide (PubChem CID 58214079) has the molecular formula C23H27N3O2S and a molecular weight of 422.63 g/mol. Its IUPAC name is 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1,4,4-tetradeuterio-5-hydroxy-5-(2,3,5,6-tetradeuterio-4-methylphenyl)pentyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1,4,4-tetradeuterio-5-hydroxy-5-(2,3,5,6-tetradeuterio-4-methylphenyl)pentyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58214079 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-(2-amino-5-deuterio-1,3-thiazol-4-yl)-N-[2,3,5,6-tetradeuterio-4-[(5S)-1,1,4,4-tetradeuterio-5-hydroxy-5-(2,3,5,6-tetradeuterio-4-methylphenyl)pentyl]phenyl]acetamide |
| SMILES | [2H]c1sc(N)nc1CC(=O)Nc1c([2H])c([2H])c(C([2H])([2H])CCC([2H])([2H])[C@H](O)c2c([2H])c([2H])c(C)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C23H27N3O2S/c1-16-6-10-18(11-7-16)21(27)5-3-2-4-17-8-12-19(13-9-17)25-22(28)14-20-15-29-23(24)26-20/h6-13,15,21,27H,2-5,14H2,1H3,(H2,24,26)(H,25,28)/t21-/m0/s1/i4D2,5D2,6D,7D,8D,9D,10D,11D,12D,13D,15D |
| InChIKey | IRSRFMJKIMHDMD-JLLRHEPVSA-N |
| XLogP | 4.66 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |