C43H45N6O4S+3 — CID 58214342
2-[2-(4-carboxyphenyl)ethyl]-3,5,6-tris[4-(dimethylamino)pyridin-1-ium-1-yl]-4-phenylsulfanylbenzoic acid (PubChem CID 58214342) has the molecular formula C43H45N6O4S+3 and a molecular weight of 741.94 g/mol. Its IUPAC name is 2-[2-(4-carboxyphenyl)ethyl]-3,5,6-tris[4-(dimethylamino)pyridin-1-ium-1-yl]-4-phenylsulfanylbenzoic acid.
| Compound Name | 2-[2-(4-carboxyphenyl)ethyl]-3,5,6-tris[4-(dimethylamino)pyridin-1-ium-1-yl]-4-phenylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 58214342 |
| Molecular Formula | C43H45N6O4S+3 |
| Molecular Weight | 741.94 g/mol |
| Exact Mass | 741.32 |
| IUPAC Name | 2-[2-(4-carboxyphenyl)ethyl]-3,5,6-tris[4-(dimethylamino)pyridin-1-ium-1-yl]-4-phenylsulfanylbenzoic acid |
| SMILES | CN(C)c1cc[n+](-c2c(CCc3ccc(C(=O)O)cc3)c(C(=O)O)c(-[n+]3ccc(N(C)C)cc3)c(-[n+]3ccc(N(C)C)cc3)c2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C43H43N6O4S/c1-44(2)32-18-24-47(25-19-32)38-36(17-14-30-12-15-31(16-13-30)42(50)51)37(43(52)53)39(48-26-20-33(21-27-48)45(3)4)40(41(38)54-35-10-8-7-9-11-35)49-28-22-34(23-29-49)46(5)6/h7-13,15-16,18-29H,14,17H2,1-6H3/q+1/p+2 |
| InChIKey | AWYPFNFEUPRQRF-UHFFFAOYSA-P |
| XLogP | 6.05 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.94 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|