C22H27F3N2O2 — CID 58214388
N'-[2,5-dimethyl-4-[3-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214388) has the molecular formula C22H27F3N2O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[3-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[3-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58214388 |
| Molecular Formula | C22H27F3N2O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[2,5-dimethyl-4-[3-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2cccc(C(C)(OC)C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C22H27F3N2O2/c1-7-27(5)14-26-19-11-16(3)20(12-15(19)2)29-18-10-8-9-17(13-18)21(4,28-6)22(23,24)25/h8-14H,7H2,1-6H3/b26-14+ |
| InChIKey | RTWUNXSKOCTZBH-VULFUBBASA-N |
| XLogP | 6.13 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|