C42H51N2O8P — CID 58215009
[(4R,7Z,18R)-14-(2-cyclopentyloxy-2-oxoethyl)-18-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]-methylphosphinic acid (PubChem CID 58215009) has the molecular formula C42H51N2O8P and a molecular weight of 742.85 g/mol. Its IUPAC name is [(4R,7Z,18R)-14-(2-cyclopentyloxy-2-oxoethyl)-18-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]-methylphosphinic acid.
| Compound Name | [(4R,7Z,18R)-14-(2-cyclopentyloxy-2-oxoethyl)-18-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]-methylphosphinic acid |
|---|---|
| PubChem CID | 58215009 |
| Molecular Formula | C42H51N2O8P |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | [(4R,7Z,18R)-14-(2-cyclopentyloxy-2-oxoethyl)-18-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]-methylphosphinic acid |
| SMILES | COc1ccc2c(O[C@@H]3CC4C(=O)C[C@]5(P(C)(=O)O)CC5/C=C\CCCCCC(CC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C42H51N2O8P/c1-50-32-19-20-34-36(22-32)43-35(28-13-8-6-9-14-28)24-39(34)51-33-23-37-38(45)26-42(53(2,48)49)25-30(42)16-10-5-3-4-7-15-29(41(47)44(37)27-33)21-40(46)52-31-17-11-12-18-31/h6,8-10,13-14,16,19-20,22,24,29-31,33,37H,3-5,7,11-12,15,17-18,21,23,25-27H2,1-2H3,(H,48,49)/b16-10-/t29?,30?,33-,37?,42-/m1/s1 |
| InChIKey | RSBYTXVWHHOFFS-BYQYDDEXSA-N |
| XLogP | 7.89 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|