C33H34N2O7 — CID 58451324
(1S,4R,6S,7Z,17R)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-13-oxa-15-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 58451324) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is (1S,4R,6S,7Z,17R)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-13-oxa-15-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,6S,7Z,17R)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-13-oxa-15-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 58451324 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (1S,4R,6S,7Z,17R)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-13-oxa-15-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)C[C@]5(C(=O)O)C[C@H]5/C=C\CCCCOC(=O)N4C3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C33H34N2O7/c1-40-23-12-13-25-27(15-23)34-26(21-9-5-4-6-10-21)17-30(25)42-24-16-28-29(36)19-33(31(37)38)18-22(33)11-7-2-3-8-14-41-32(39)35(28)20-24/h4-7,9-13,15,17,22,24,28H,2-3,8,14,16,18-20H2,1H3,(H,37,38)/b11-7-/t22-,24-,28+,33-/m1/s1 |
| InChIKey | SAAVLOVLTSBTDT-GBNOUYCRSA-N |
| XLogP | 5.66 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|