C21H22Cl2N3O3S- — CID 58215123
4-[(3R)-3-[(3S)-4-(3,5-dichlorophenyl)-3-methylpiperazin-1-yl]-2-oxopyrrolidin-1-yl]benzenesulfinate (PubChem CID 58215123) has the molecular formula C21H22Cl2N3O3S- and a molecular weight of 467.40 g/mol. Its IUPAC name is 4-[(3R)-3-[(3S)-4-(3,5-dichlorophenyl)-3-methylpiperazin-1-yl]-2-oxopyrrolidin-1-yl]benzenesulfinate.
| Compound Name | 4-[(3R)-3-[(3S)-4-(3,5-dichlorophenyl)-3-methylpiperazin-1-yl]-2-oxopyrrolidin-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 58215123 |
| Molecular Formula | C21H22Cl2N3O3S- |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-[(3R)-3-[(3S)-4-(3,5-dichlorophenyl)-3-methylpiperazin-1-yl]-2-oxopyrrolidin-1-yl]benzenesulfinate |
| SMILES | C[C@H]1CN([C@@H]2CCN(c3ccc(S(=O)[O-])cc3)C2=O)CCN1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-14-13-24(8-9-25(14)18-11-15(22)10-16(23)12-18)20-6-7-26(21(20)27)17-2-4-19(5-3-17)30(28)29/h2-5,10-12,14,20H,6-9,13H2,1H3,(H,28,29)/p-1/t14-,20+/m0/s1 |
| InChIKey | YWJHXMVCJSFEED-VBKZILBWSA-M |
| XLogP | 3.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|