C22H22FN4O3S2- — CID 158742916
4-[(3S)-3-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine (PubChem CID 158742916) has the molecular formula C22H22FN4O3S2- and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-[(3S)-3-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine.
| Compound Name | 4-[(3S)-3-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 158742916 |
| Molecular Formula | C22H22FN4O3S2- |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-[(3S)-3-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine |
| SMILES | Nc1nccs1.O=C1[C@@H](N2CCCc3cc(F)ccc32)CCN1c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C19H19FN2O3S.C3H4N2S/c20-14-3-8-17-13(12-14)2-1-10-22(17)18-9-11-21(19(18)23)15-4-6-16(7-5-15)26(24)25;4-3-5-1-2-6-3/h3-8,12,18H,1-2,9-11H2,(H,24,25);1-2H,(H2,4,5)/p-1/t18-;/m0./s1 |
| InChIKey | GDGZVBAZAIYNCL-FERBBOLQSA-M |
| XLogP | 3.35 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|