C21H19F2N3O2 — CID 97011711
4-[(3R)-3-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-2-oxopyrrolidin-1-yl]benzonitrile (PubChem CID 97011711) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[(3R)-3-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-2-oxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3R)-3-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-2-oxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 97011711 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-[(3R)-3-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-2-oxopyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CC[C@@H](N3CCCc4cc(OC(F)F)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C21H19F2N3O2/c22-21(23)28-17-7-8-18-15(12-17)2-1-10-26(18)19-9-11-25(20(19)27)16-5-3-14(13-24)4-6-16/h3-8,12,19,21H,1-2,9-11H2/t19-/m1/s1 |
| InChIKey | AWIXGHZMSZHQNB-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|