C23H25ClN4O4S — CID 135965515
(Z)-N'-[4-[(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]phenyl]sulfonyl-3-hydroxybut-2-enimidamide (PubChem CID 135965515) has the molecular formula C23H25ClN4O4S and a molecular weight of 489.00 g/mol. Its IUPAC name is (Z)-N'-[4-[(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]phenyl]sulfonyl-3-hydroxybut-2-enimidamide.
| Compound Name | (Z)-N'-[4-[(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]phenyl]sulfonyl-3-hydroxybut-2-enimidamide |
|---|---|
| PubChem CID | 135965515 |
| Molecular Formula | C23H25ClN4O4S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (Z)-N'-[4-[(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-oxopyrrolidin-1-yl]phenyl]sulfonyl-3-hydroxybut-2-enimidamide |
| SMILES | C/C(O)=C/C(N)=N\S(=O)(=O)c1ccc(N2CC[C@H](N3CCCc4cc(Cl)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C23H25ClN4O4S/c1-15(29)13-22(25)26-33(31,32)19-7-5-18(6-8-19)27-12-10-21(23(27)30)28-11-2-3-16-14-17(24)4-9-20(16)28/h4-9,13-14,21,29H,2-3,10-12H2,1H3,(H2,25,26)/b15-13-/t21-/m0/s1 |
| InChIKey | RAWODSMEYLJNBU-ROOORRATSA-N |
| XLogP | 3.41 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|