About (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one
(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one (PubChem CID 59465621) has the molecular formula C13H14ClNO2
and a molecular weight of 251.71 g/mol. Its IUPAC name is (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one.
Molecular Properties
| Compound Name | (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one |
| PubChem CID | 59465621 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1N1CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H14ClNO2/c14-10-3-4-11-9(8-10)2-1-6-15(11)12-5-7-17-13(12)16/h3-4,8,12H,1-2,5-7H2/t12-/m0/s1 |
| InChIKey | NQEUCZBHGAFVAZ-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one?
The IUPAC name of (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one (CID 59465621) is (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one.
What is the SMILES notation for (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one?
The canonical SMILES for (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one is O=C1OCC[C@@H]1N1CCCc2cc(Cl)ccc21.
What is the InChIKey of (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one?
The InChIKey is NQEUCZBHGAFVAZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H14ClNO2/c14-10-3-4-11-9(8-10)2-1-6-15(11)12-5-7-17-13(12)16/h3-4,8,12H,1-2,5-7H2/t12-/m0/s1.
What are the key properties of (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one?
(3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one has a molecular weight of 251.71 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)oxolan-2-one is sourced from PubChem (CID 59465621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).