C26H31ClN6O3S — CID 123385858
N'-[4-[4-[(2R)-2-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-4-iminobut-2-enimidamide (PubChem CID 123385858) has the molecular formula C26H31ClN6O3S and a molecular weight of 543.09 g/mol. Its IUPAC name is N'-[4-[4-[(2R)-2-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-4-iminobut-2-enimidamide.
| Compound Name | N'-[4-[4-[(2R)-2-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-4-iminobut-2-enimidamide |
|---|---|
| PubChem CID | 123385858 |
| Molecular Formula | C26H31ClN6O3S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N'-[4-[4-[(2R)-2-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-4-iminobut-2-enimidamide |
| SMILES | [H]/N=C/C=CC(N)=NS(=O)(=O)c1ccc(N2CCN(C(=O)[C@@H](C)N3CCCc4cc(Cl)ccc43)CC2)cc1 |
| InChI | InChI=1S/C26H31ClN6O3S/c1-19(33-13-3-4-20-18-21(27)6-11-24(20)33)26(34)32-16-14-31(15-17-32)22-7-9-23(10-8-22)37(35,36)30-25(29)5-2-12-28/h2,5-12,18-19,28H,3-4,13-17H2,1H3,(H2,29,30)/b5-2?,28-12+/t19-/m1/s1 |
| InChIKey | OSDXKQDSXSYQAY-WYPNZRKFSA-N |
| XLogP | 3.08 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|