C26H32FN5O4S — CID 91563289
N-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-3-iminobutanamide (PubChem CID 91563289) has the molecular formula C26H32FN5O4S and a molecular weight of 529.64 g/mol. Its IUPAC name is N-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-3-iminobutanamide.
| Compound Name | N-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-3-iminobutanamide |
|---|---|
| PubChem CID | 91563289 |
| Molecular Formula | C26H32FN5O4S |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonyl-3-iminobutanamide |
| SMILES | [H]/N=C(\C)CC(=O)NS(=O)(=O)c1ccc(N2CCN(C(=O)[C@@H](C)N3CCCc4cc(F)ccc43)CC2)cc1 |
| InChI | InChI=1S/C26H32FN5O4S/c1-18(28)16-25(33)29-37(35,36)23-8-6-22(7-9-23)30-12-14-31(15-13-30)26(34)19(2)32-11-3-4-20-17-21(27)5-10-24(20)32/h5-10,17,19,28H,3-4,11-16H2,1-2H3,(H,29,33)/b28-18+/t19-/m1/s1 |
| InChIKey | TUNSSUPIBTVWPJ-AZFHEMCLSA-N |
| XLogP | 2.55 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|