C24H29FN6O3S2 — CID 90893888
1-(aminomethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea (PubChem CID 90893888) has the molecular formula C24H29FN6O3S2 and a molecular weight of 532.67 g/mol. Its IUPAC name is 1-(aminomethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea.
| Compound Name | 1-(aminomethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea |
|---|---|
| PubChem CID | 90893888 |
| Molecular Formula | C24H29FN6O3S2 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1-(aminomethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea |
| SMILES | C[C@H](C(=O)N1CCN(c2ccc(S(=O)(=O)NC(=S)N=CN)cc2)CC1)N1CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C24H29FN6O3S2/c1-17(31-10-2-3-18-15-19(25)4-9-22(18)31)23(32)30-13-11-29(12-14-30)20-5-7-21(8-6-20)36(33,34)28-24(35)27-16-26/h4-9,15-17H,2-3,10-14H2,1H3,(H3,26,27,28,35)/t17-/m1/s1 |
| InChIKey | RPIBFRQVKSQVHF-QGZVFWFLSA-N |
| XLogP | 1.87 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|