C19H17ClN2O4S — CID 58215306
4-[3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzenesulfinic acid (PubChem CID 58215306) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is 4-[3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzenesulfinic acid.
| Compound Name | 4-[3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzenesulfinic acid |
|---|---|
| PubChem CID | 58215306 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-[3-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzenesulfinic acid |
| SMILES | O=C1CC(N2CCCc3cc(Cl)ccc32)C(=O)N1c1ccc(S(=O)O)cc1 |
| InChI | InChI=1S/C19H17ClN2O4S/c20-13-3-8-16-12(10-13)2-1-9-21(16)17-11-18(23)22(19(17)24)14-4-6-15(7-5-14)27(25)26/h3-8,10,17H,1-2,9,11H2,(H,25,26) |
| InChIKey | KQFHYTVHKAUBMG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|