C21H22ClN5 — CID 58215730
2-[5-[(4-aminopiperidin-1-yl)methyl]-3-pyridinyl]-6-chloro-1-methylindole-3-carbonitrile (PubChem CID 58215730) has the molecular formula C21H22ClN5 and a molecular weight of 379.90 g/mol. Its IUPAC name is 2-[5-[(4-aminopiperidin-1-yl)methyl]-3-pyridinyl]-6-chloro-1-methylindole-3-carbonitrile.
| Compound Name | 2-[5-[(4-aminopiperidin-1-yl)methyl]-3-pyridinyl]-6-chloro-1-methylindole-3-carbonitrile |
|---|---|
| PubChem CID | 58215730 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[5-[(4-aminopiperidin-1-yl)methyl]-3-pyridinyl]-6-chloro-1-methylindole-3-carbonitrile |
| SMILES | Cn1c(-c2cncc(CN3CCC(N)CC3)c2)c(C#N)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H22ClN5/c1-26-20-9-16(22)2-3-18(20)19(10-23)21(26)15-8-14(11-25-12-15)13-27-6-4-17(24)5-7-27/h2-3,8-9,11-12,17H,4-7,13,24H2,1H3 |
| InChIKey | WJDAVQCGZSTBRW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |