C16H13N3O — CID 58215788
1-(hydroxymethyl)-3-methyl-2-pyridin-3-ylindole-5-carbonitrile (PubChem CID 58215788) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3-methyl-2-pyridin-3-ylindole-5-carbonitrile.
| Compound Name | 1-(hydroxymethyl)-3-methyl-2-pyridin-3-ylindole-5-carbonitrile |
|---|---|
| PubChem CID | 58215788 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(hydroxymethyl)-3-methyl-2-pyridin-3-ylindole-5-carbonitrile |
| SMILES | Cc1c(-c2cccnc2)n(CO)c2ccc(C#N)cc12 |
| InChI | InChI=1S/C16H13N3O/c1-11-14-7-12(8-17)4-5-15(14)19(10-20)16(11)13-3-2-6-18-9-13/h2-7,9,20H,10H2,1H3 |
| InChIKey | XRPUPIWHCIJSOV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |