C16H13N3 — CID 123248615
1,3-dimethyl-2-pyridin-3-ylindole-5-carbonitrile (PubChem CID 123248615) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1,3-dimethyl-2-pyridin-3-ylindole-5-carbonitrile.
| Compound Name | 1,3-dimethyl-2-pyridin-3-ylindole-5-carbonitrile |
|---|---|
| PubChem CID | 123248615 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1,3-dimethyl-2-pyridin-3-ylindole-5-carbonitrile |
| SMILES | Cc1c(-c2cccnc2)n(C)c2ccc(C#N)cc12 |
| InChI | InChI=1S/C16H13N3/c1-11-14-8-12(9-17)5-6-15(14)19(2)16(11)13-4-3-7-18-10-13/h3-8,10H,1-2H3 |
| InChIKey | CKZDKWLPTKEYBA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |