C10H10N2S2 — CID 118671589
3,5-dimethyl-4-pyridin-3-yl-1,3-thiazole-2-thione (PubChem CID 118671589) has the molecular formula C10H10N2S2 and a molecular weight of 222.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-pyridin-3-yl-1,3-thiazole-2-thione.
| Compound Name | 3,5-dimethyl-4-pyridin-3-yl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 118671589 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 3,5-dimethyl-4-pyridin-3-yl-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)n(C)c1-c1cccnc1 |
| InChI | InChI=1S/C10H10N2S2/c1-7-9(12(2)10(13)14-7)8-4-3-5-11-6-8/h3-6H,1-2H3 |
| InChIKey | YSEFLMFYAHCQPN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|