C28H28N4O2S — CID 58217202
methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate (PubChem CID 58217202) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate.
| Compound Name | methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217202 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate |
| SMILES | CCCCCn1c(-c2cccc3nc(NCc4ccccc4)sc23)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C28H28N4O2S/c1-3-4-8-16-32-24-15-14-20(27(33)34-2)17-23(24)30-26(32)21-12-9-13-22-25(21)35-28(31-22)29-18-19-10-6-5-7-11-19/h5-7,9-15,17H,3-4,8,16,18H2,1-2H3,(H,29,31) |
| InChIKey | ZTWDRLSCPPCKIZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|