C30H26F6N2O3S2 — CID 58219139
2-[[2-(4-methoxy-2-sulfanylanilino)-1,2-bis[2-(trifluoromethoxy)phenyl]ethyl]amino]-5-methylbenzenethiol (PubChem CID 58219139) has the molecular formula C30H26F6N2O3S2 and a molecular weight of 640.67 g/mol. Its IUPAC name is 2-[[2-(4-methoxy-2-sulfanylanilino)-1,2-bis[2-(trifluoromethoxy)phenyl]ethyl]amino]-5-methylbenzenethiol.
| Compound Name | 2-[[2-(4-methoxy-2-sulfanylanilino)-1,2-bis[2-(trifluoromethoxy)phenyl]ethyl]amino]-5-methylbenzenethiol |
|---|---|
| PubChem CID | 58219139 |
| Molecular Formula | C30H26F6N2O3S2 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | 2-[[2-(4-methoxy-2-sulfanylanilino)-1,2-bis[2-(trifluoromethoxy)phenyl]ethyl]amino]-5-methylbenzenethiol |
| SMILES | COc1ccc(NC(c2ccccc2OC(F)(F)F)C(Nc2ccc(C)cc2S)c2ccccc2OC(F)(F)F)c(S)c1 |
| InChI | InChI=1S/C30H26F6N2O3S2/c1-17-11-13-21(25(42)15-17)37-27(19-7-3-5-9-23(19)40-29(31,32)33)28(38-22-14-12-18(39-2)16-26(22)43)20-8-4-6-10-24(20)41-30(34,35)36/h3-16,27-28,37-38,42-43H,1-2H3 |
| InChIKey | JICUHODPYDSIGJ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|