C27H33NO — CID 58219162
3,5-ditert-butyl-2-methyl-N-(2-phenoxyphenyl)aniline (PubChem CID 58219162) has the molecular formula C27H33NO and a molecular weight of 387.57 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-methyl-N-(2-phenoxyphenyl)aniline.
| Compound Name | 3,5-ditert-butyl-2-methyl-N-(2-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 58219162 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 3,5-ditert-butyl-2-methyl-N-(2-phenoxyphenyl)aniline |
| SMILES | Cc1c(Nc2ccccc2Oc2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H33NO/c1-19-22(27(5,6)7)17-20(26(2,3)4)18-24(19)28-23-15-11-12-16-25(23)29-21-13-9-8-10-14-21/h8-18,28H,1-7H3 |
| InChIKey | VVYJHSJUXXFWIE-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |