C24H31Cl2N3O4 — CID 58219404
(4S,7S)-8-[2-(3,4-dichlorophenyl)acetyl]-4-[[(8S)-8-hydroxy-6-azaspiro[2.5]octan-6-yl]methyl]-7-methyl-2,3,4,7,9,9a-hexahydropyrazino[2,1-b][1,3]oxazin-6-one (PubChem CID 58219404) has the molecular formula C24H31Cl2N3O4 and a molecular weight of 496.44 g/mol. Its IUPAC name is (4S,7S)-8-[2-(3,4-dichlorophenyl)acetyl]-4-[[(8S)-8-hydroxy-6-azaspiro[2.5]octan-6-yl]methyl]-7-methyl-2,3,4,7,9,9a-hexahydropyrazino[2,1-b][1,3]oxazin-6-one.
| Compound Name | (4S,7S)-8-[2-(3,4-dichlorophenyl)acetyl]-4-[[(8S)-8-hydroxy-6-azaspiro[2.5]octan-6-yl]methyl]-7-methyl-2,3,4,7,9,9a-hexahydropyrazino[2,1-b][1,3]oxazin-6-one |
|---|---|
| PubChem CID | 58219404 |
| Molecular Formula | C24H31Cl2N3O4 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (4S,7S)-8-[2-(3,4-dichlorophenyl)acetyl]-4-[[(8S)-8-hydroxy-6-azaspiro[2.5]octan-6-yl]methyl]-7-methyl-2,3,4,7,9,9a-hexahydropyrazino[2,1-b][1,3]oxazin-6-one |
| SMILES | C[C@H]1C(=O)N2C(CN1C(=O)Cc1ccc(Cl)c(Cl)c1)OCC[C@H]2CN1CCC2(CC2)[C@H](O)C1 |
| InChI | InChI=1S/C24H31Cl2N3O4/c1-15-23(32)29-17(12-27-8-7-24(5-6-24)20(30)13-27)4-9-33-22(29)14-28(15)21(31)11-16-2-3-18(25)19(26)10-16/h2-3,10,15,17,20,22,30H,4-9,11-14H2,1H3/t15-,17-,20+,22?/m0/s1 |
| InChIKey | XYLTVTQXOBQYAX-BUQZIYKDSA-N |
| XLogP | 2.56 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |