C15H18ClFO4 — CID 58222058
(2S)-2-[(4-chloro-2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 58222058) has the molecular formula C15H18ClFO4 and a molecular weight of 316.76 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(4-chloro-2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58222058 |
| Molecular Formula | C15H18ClFO4 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2S)-2-[(4-chloro-2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)C[C@H](Cc1ccc(Cl)cc1F)C(=O)O |
| InChI | InChI=1S/C15H18ClFO4/c1-15(2,3)21-13(18)7-10(14(19)20)6-9-4-5-11(16)8-12(9)17/h4-5,8,10H,6-7H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | GRIRWSCWJBDCLC-JTQLQIEISA-N |
| XLogP | 3.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |