C7H12N2O — CID 58223609
4,5-diethyl-1,2-dihydropyrazol-3-one (PubChem CID 58223609) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4,5-diethyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4,5-diethyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 58223609 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4,5-diethyl-1,2-dihydropyrazol-3-one |
| SMILES | CCc1[nH][nH]c(=O)c1CC |
| InChI | InChI=1S/C7H12N2O/c1-3-5-6(4-2)8-9-7(5)10/h3-4H2,1-2H3,(H2,8,9,10) |
| InChIKey | UILRPGCUWJBENQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |