C9H17N3O — CID 4715337
4-(2-aminoethyl)-5-tert-butyl-1,2-dihydropyrazol-3-one (PubChem CID 4715337) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5-tert-butyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-(2-aminoethyl)-5-tert-butyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 4715337 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 4-(2-aminoethyl)-5-tert-butyl-1,2-dihydropyrazol-3-one |
| SMILES | CC(C)(C)c1[nH][nH]c(=O)c1CCN |
| InChI | InChI=1S/C9H17N3O/c1-9(2,3)7-6(4-5-10)8(13)12-11-7/h4-5,10H2,1-3H3,(H2,11,12,13) |
| InChIKey | DBPGMSYKGUQMMM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |