C21H32N2O4 — CID 58223912
N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide (PubChem CID 58223912) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide.
| Compound Name | N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 58223912 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide |
| SMILES | CC(C)CC(=O)CCCOCCN(C)C(=O)CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O4/c1-17(2)15-19(24)11-8-13-27-14-12-22(3)20(25)16-21(26)23(4)18-9-6-5-7-10-18/h5-7,9-10,17H,8,11-16H2,1-4H3 |
| InChIKey | JGKNXBMQELPETF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|