About N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide
N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide (PubChem CID 58223912) has the molecular formula C21H32N2O4
and a molecular weight of 376.50 g/mol. Its IUPAC name is N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide.
Molecular Properties
| Compound Name | N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide |
| PubChem CID | 58223912 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide |
| SMILES | CC(C)CC(=O)CCCOCCN(C)C(=O)CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O4/c1-17(2)15-19(24)11-8-13-27-14-12-22(3)20(25)16-21(26)23(4)18-9-6-5-7-10-18/h5-7,9-10,17H,8,11-16H2,1-4H3 |
| InChIKey | JGKNXBMQELPETF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide?
The IUPAC name of N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide (CID 58223912) is N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide.
What is the SMILES notation for N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide?
The canonical SMILES for N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide is CC(C)CC(=O)CCCOCCN(C)C(=O)CC(=O)N(C)c1ccccc1.
What is the InChIKey of N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide?
The InChIKey is JGKNXBMQELPETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O4/c1-17(2)15-19(24)11-8-13-27-14-12-22(3)20(25)16-21(26)23(4)18-9-6-5-7-10-18/h5-7,9-10,17H,8,11-16H2,1-4H3.
What are the key properties of N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide?
N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide has a molecular weight of 376.50 g/mol, XLogP of 2.91, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N-[2-(6-methyl-4-oxoheptoxy)ethyl]-N'-phenylpropanediamide is sourced from PubChem (CID 58223912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).