About methyl 5-oxo-4H-1,2-oxazole-4-carboxylate
methyl 5-oxo-4H-1,2-oxazole-4-carboxylate (PubChem CID 58226252) has the molecular formula C5H5NO4
and a molecular weight of 143.10 g/mol. Its IUPAC name is methyl 5-oxo-4H-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-4H-1,2-oxazole-4-carboxylate |
| PubChem CID | 58226252 |
| Molecular Formula | C5H5NO4 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | methyl 5-oxo-4H-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)C1C=NOC1=O |
| InChI | InChI=1S/C5H5NO4/c1-9-4(7)3-2-6-10-5(3)8/h2-3H,1H3 |
| InChIKey | FGVPJCNSQLGKSA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxo-4H-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-4H-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 5-oxo-4H-1,2-oxazole-4-carboxylate (CID 58226252) is methyl 5-oxo-4H-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-oxo-4H-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-oxo-4H-1,2-oxazole-4-carboxylate is COC(=O)C1C=NOC1=O.
What is the InChIKey of methyl 5-oxo-4H-1,2-oxazole-4-carboxylate?
The InChIKey is FGVPJCNSQLGKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4/c1-9-4(7)3-2-6-10-5(3)8/h2-3H,1H3.
What are the key properties of methyl 5-oxo-4H-1,2-oxazole-4-carboxylate?
methyl 5-oxo-4H-1,2-oxazole-4-carboxylate has a molecular weight of 143.10 g/mol, XLogP of -0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-4H-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 58226252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).