About methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate
methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate (PubChem CID 98048884) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate.
Analyze methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate (CID 98048884) is methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate is COC(=O)[C@H]1C=NOC1.
What is the InChIKey of methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate?
The InChIKey is CHWXLBUERLBMSN-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H7NO3/c1-8-5(7)4-2-6-9-3-4/h2,4H,3H2,1H3/t4-/m0/s1.
What are the key properties of methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate?
methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate has a molecular weight of 129.11 g/mol, XLogP of -0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-4,5-dihydro-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 98048884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).